C17H20N2O4S2 — CID 51183821
4-[1-[methyl-[(E)-2-phenylethenyl]sulfonylamino]ethyl]benzenesulfonamide (PubChem CID 51183821) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 4-[1-[methyl-[(E)-2-phenylethenyl]sulfonylamino]ethyl]benzenesulfonamide.
| Compound Name | 4-[1-[methyl-[(E)-2-phenylethenyl]sulfonylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51183821 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 4-[1-[methyl-[(E)-2-phenylethenyl]sulfonylamino]ethyl]benzenesulfonamide |
| SMILES | CC(c1ccc(S(N)(=O)=O)cc1)N(C)S(=O)(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H20N2O4S2/c1-14(16-8-10-17(11-9-16)25(18,22)23)19(2)24(20,21)13-12-15-6-4-3-5-7-15/h3-14H,1-2H3,(H2,18,22,23)/b13-12+ |
| InChIKey | SCWRYNOCDLJXIA-OUKQBFOZSA-N |
| XLogP | 2.33 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |