C16H17N3O3S — CID 51086703
4-[1-[1,3-benzoxazol-2-yl(methyl)amino]ethyl]benzenesulfonamide (PubChem CID 51086703) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is 4-[1-[1,3-benzoxazol-2-yl(methyl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[1-[1,3-benzoxazol-2-yl(methyl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 51086703 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 4-[1-[1,3-benzoxazol-2-yl(methyl)amino]ethyl]benzenesulfonamide |
| SMILES | CC(c1ccc(S(N)(=O)=O)cc1)N(C)c1nc2ccccc2o1 |
| InChI | InChI=1S/C16H17N3O3S/c1-11(12-7-9-13(10-8-12)23(17,20)21)19(2)16-18-14-5-3-4-6-15(14)22-16/h3-11H,1-2H3,(H2,17,20,21) |
| InChIKey | AWPIAAKEXUPEGV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |