C16H17N3O3S — CID 95329361
3-[(1R)-1-(1,3-benzoxazol-2-ylamino)propyl]benzenesulfonamide (PubChem CID 95329361) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is 3-[(1R)-1-(1,3-benzoxazol-2-ylamino)propyl]benzenesulfonamide.
| Compound Name | 3-[(1R)-1-(1,3-benzoxazol-2-ylamino)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 95329361 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 3-[(1R)-1-(1,3-benzoxazol-2-ylamino)propyl]benzenesulfonamide |
| SMILES | CC[C@@H](Nc1nc2ccccc2o1)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C16H17N3O3S/c1-2-13(11-6-5-7-12(10-11)23(17,20)21)18-16-19-14-8-3-4-9-15(14)22-16/h3-10,13H,2H2,1H3,(H,18,19)(H2,17,20,21)/t13-/m1/s1 |
| InChIKey | MFZZPQGAHSUZKY-CYBMUJFWSA-N |
| XLogP | 3.04 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |