C17H20N4O2S — CID 86787334
3-[1-(imidazo[1,2-a]pyridin-2-ylmethylamino)propyl]benzenesulfonamide (PubChem CID 86787334) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 3-[1-(imidazo[1,2-a]pyridin-2-ylmethylamino)propyl]benzenesulfonamide.
| Compound Name | 3-[1-(imidazo[1,2-a]pyridin-2-ylmethylamino)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 86787334 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 3-[1-(imidazo[1,2-a]pyridin-2-ylmethylamino)propyl]benzenesulfonamide |
| SMILES | CCC(NCc1cn2ccccc2n1)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C17H20N4O2S/c1-2-16(13-6-5-7-15(10-13)24(18,22)23)19-11-14-12-21-9-4-3-8-17(21)20-14/h3-10,12,16,19H,2,11H2,1H3,(H2,18,22,23) |
| InChIKey | RNEWVFVHPICJQY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |