C14H15F3N4O2S — CID 133433693
4-[1-[methyl-[6-(trifluoromethyl)pyridazin-3-yl]amino]ethyl]benzenesulfonamide (PubChem CID 133433693) has the molecular formula C14H15F3N4O2S and a molecular weight of 360.36 g/mol. Its IUPAC name is 4-[1-[methyl-[6-(trifluoromethyl)pyridazin-3-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[1-[methyl-[6-(trifluoromethyl)pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 133433693 |
| Molecular Formula | C14H15F3N4O2S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 4-[1-[methyl-[6-(trifluoromethyl)pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
| SMILES | CC(c1ccc(S(N)(=O)=O)cc1)N(C)c1ccc(C(F)(F)F)nn1 |
| InChI | InChI=1S/C14H15F3N4O2S/c1-9(10-3-5-11(6-4-10)24(18,22)23)21(2)13-8-7-12(19-20-13)14(15,16)17/h3-9H,1-2H3,(H2,18,22,23) |
| InChIKey | ONVYFGHIWRTSBP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |