C12H16F3N3O3S — CID 94117936
1-methyl-1-[(1S)-1-(4-sulfamoylphenyl)ethyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 94117936) has the molecular formula C12H16F3N3O3S and a molecular weight of 339.34 g/mol. Its IUPAC name is 1-methyl-1-[(1S)-1-(4-sulfamoylphenyl)ethyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-methyl-1-[(1S)-1-(4-sulfamoylphenyl)ethyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 94117936 |
| Molecular Formula | C12H16F3N3O3S |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 1-methyl-1-[(1S)-1-(4-sulfamoylphenyl)ethyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | C[C@@H](c1ccc(S(N)(=O)=O)cc1)N(C)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C12H16F3N3O3S/c1-8(18(2)11(19)17-7-12(13,14)15)9-3-5-10(6-4-9)22(16,20)21/h3-6,8H,7H2,1-2H3,(H,17,19)(H2,16,20,21)/t8-/m0/s1 |
| InChIKey | IURLNKCPZJOWON-QMMMGPOBSA-N |
| XLogP | 1.60 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |