C20H27N3O5S — CID 42957502
3-[2-(3,4-dimethoxyphenyl)ethyl]-1-methyl-1-[1-(4-sulfamoylphenyl)ethyl]urea (PubChem CID 42957502) has the molecular formula C20H27N3O5S and a molecular weight of 421.52 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)ethyl]-1-methyl-1-[1-(4-sulfamoylphenyl)ethyl]urea.
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-1-methyl-1-[1-(4-sulfamoylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 42957502 |
| Molecular Formula | C20H27N3O5S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)ethyl]-1-methyl-1-[1-(4-sulfamoylphenyl)ethyl]urea |
| SMILES | COc1ccc(CCNC(=O)N(C)C(C)c2ccc(S(N)(=O)=O)cc2)cc1OC |
| InChI | InChI=1S/C20H27N3O5S/c1-14(16-6-8-17(9-7-16)29(21,25)26)23(2)20(24)22-12-11-15-5-10-18(27-3)19(13-15)28-4/h5-10,13-14H,11-12H2,1-4H3,(H,22,24)(H2,21,25,26) |
| InChIKey | YXJCSRKFDKTQBN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |