C19H23ClN2O2 — CID 51935182
1-[(1R)-1-(4-chlorophenyl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]-1-methylurea (PubChem CID 51935182) has the molecular formula C19H23ClN2O2 and a molecular weight of 346.86 g/mol. Its IUPAC name is 1-[(1R)-1-(4-chlorophenyl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]-1-methylurea.
| Compound Name | 1-[(1R)-1-(4-chlorophenyl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]-1-methylurea |
|---|---|
| PubChem CID | 51935182 |
| Molecular Formula | C19H23ClN2O2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-[(1R)-1-(4-chlorophenyl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]-1-methylurea |
| SMILES | COc1ccc(CCNC(=O)N(C)[C@H](C)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H23ClN2O2/c1-14(16-6-8-17(20)9-7-16)22(2)19(23)21-13-12-15-4-10-18(24-3)11-5-15/h4-11,14H,12-13H2,1-3H3,(H,21,23)/t14-/m1/s1 |
| InChIKey | AEBZBKXVHJZKQU-CQSZACIVSA-N |
| XLogP | 4.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |