C21H27FN2O — CID 41096953
1-[(1S)-1-(4-fluorophenyl)ethyl]-1-methyl-3-[2-(4-propan-2-ylphenyl)ethyl]urea (PubChem CID 41096953) has the molecular formula C21H27FN2O and a molecular weight of 342.46 g/mol. Its IUPAC name is 1-[(1S)-1-(4-fluorophenyl)ethyl]-1-methyl-3-[2-(4-propan-2-ylphenyl)ethyl]urea.
| Compound Name | 1-[(1S)-1-(4-fluorophenyl)ethyl]-1-methyl-3-[2-(4-propan-2-ylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 41096953 |
| Molecular Formula | C21H27FN2O |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 1-[(1S)-1-(4-fluorophenyl)ethyl]-1-methyl-3-[2-(4-propan-2-ylphenyl)ethyl]urea |
| SMILES | CC(C)c1ccc(CCNC(=O)N(C)[C@@H](C)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H27FN2O/c1-15(2)18-7-5-17(6-8-18)13-14-23-21(25)24(4)16(3)19-9-11-20(22)12-10-19/h5-12,15-16H,13-14H2,1-4H3,(H,23,25)/t16-/m0/s1 |
| InChIKey | QPDHNEUPSBVOPS-INIZCTEOSA-N |
| XLogP | 4.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |