C15H21FN2O2 — CID 108531969
N-[2-(4-fluorophenyl)ethyl]-N'-(3-methylbutyl)oxamide (PubChem CID 108531969) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-N'-(3-methylbutyl)oxamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-N'-(3-methylbutyl)oxamide |
|---|---|
| PubChem CID | 108531969 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-N'-(3-methylbutyl)oxamide |
| SMILES | CC(C)CCNC(=O)C(=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C15H21FN2O2/c1-11(2)7-9-17-14(19)15(20)18-10-8-12-3-5-13(16)6-4-12/h3-6,11H,7-10H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | VMIPOOQDTMGUTQ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|