C19H27FN2O4 — CID 56520054
[1-[2-(4-fluorophenyl)ethylamino]-1-oxopropan-2-yl] 2-(4-methylpentanoylamino)acetate (PubChem CID 56520054) has the molecular formula C19H27FN2O4 and a molecular weight of 366.43 g/mol. Its IUPAC name is [1-[2-(4-fluorophenyl)ethylamino]-1-oxopropan-2-yl] 2-(4-methylpentanoylamino)acetate.
| Compound Name | [1-[2-(4-fluorophenyl)ethylamino]-1-oxopropan-2-yl] 2-(4-methylpentanoylamino)acetate |
|---|---|
| PubChem CID | 56520054 |
| Molecular Formula | C19H27FN2O4 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | [1-[2-(4-fluorophenyl)ethylamino]-1-oxopropan-2-yl] 2-(4-methylpentanoylamino)acetate |
| SMILES | CC(C)CCC(=O)NCC(=O)OC(C)C(=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H27FN2O4/c1-13(2)4-9-17(23)22-12-18(24)26-14(3)19(25)21-11-10-15-5-7-16(20)8-6-15/h5-8,13-14H,4,9-12H2,1-3H3,(H,21,25)(H,22,23) |
| InChIKey | FSHKTUQPQVYCRO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |