C18H24FNO3 — CID 7958995
[(2S)-1-[2-(4-fluorophenyl)ethylamino]-1-oxopropan-2-yl] cyclohexanecarboxylate (PubChem CID 7958995) has the molecular formula C18H24FNO3 and a molecular weight of 321.39 g/mol. Its IUPAC name is [(2S)-1-[2-(4-fluorophenyl)ethylamino]-1-oxopropan-2-yl] cyclohexanecarboxylate.
| Compound Name | [(2S)-1-[2-(4-fluorophenyl)ethylamino]-1-oxopropan-2-yl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 7958995 |
| Molecular Formula | C18H24FNO3 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | [(2S)-1-[2-(4-fluorophenyl)ethylamino]-1-oxopropan-2-yl] cyclohexanecarboxylate |
| SMILES | C[C@H](OC(=O)C1CCCCC1)C(=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H24FNO3/c1-13(23-18(22)15-5-3-2-4-6-15)17(21)20-12-11-14-7-9-16(19)10-8-14/h7-10,13,15H,2-6,11-12H2,1H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | MHNHOZDRBGCXGZ-ZDUSSCGKSA-N |
| XLogP | 3.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |