C18H20ClFN2O2 — CID 60580849
1-[1-(3-chloro-4-fluorophenyl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]urea (PubChem CID 60580849) has the molecular formula C18H20ClFN2O2 and a molecular weight of 350.82 g/mol. Its IUPAC name is 1-[1-(3-chloro-4-fluorophenyl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]urea.
| Compound Name | 1-[1-(3-chloro-4-fluorophenyl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 60580849 |
| Molecular Formula | C18H20ClFN2O2 |
| Molecular Weight | 350.82 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1-[1-(3-chloro-4-fluorophenyl)ethyl]-3-[2-(4-methoxyphenyl)ethyl]urea |
| SMILES | COc1ccc(CCNC(=O)NC(C)c2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H20ClFN2O2/c1-12(14-5-8-17(20)16(19)11-14)22-18(23)21-10-9-13-3-6-15(24-2)7-4-13/h3-8,11-12H,9-10H2,1-2H3,(H2,21,22,23) |
| InChIKey | DEZWNDQWBDPKPC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.82 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |