C17H17Cl2FN2O2 — CID 9440470
1-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[(4-methoxyphenyl)methyl]urea (PubChem CID 9440470) has the molecular formula C17H17Cl2FN2O2 and a molecular weight of 371.24 g/mol. Its IUPAC name is 1-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[(4-methoxyphenyl)methyl]urea.
| Compound Name | 1-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[(4-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 9440470 |
| Molecular Formula | C17H17Cl2FN2O2 |
| Molecular Weight | 371.24 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 1-[(1R)-1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[(4-methoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CNC(=O)N[C@H](C)c2cc(F)c(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H17Cl2FN2O2/c1-10(13-7-16(20)15(19)8-14(13)18)22-17(23)21-9-11-3-5-12(24-2)6-4-11/h3-8,10H,9H2,1-2H3,(H2,21,22,23)/t10-/m1/s1 |
| InChIKey | LYFPCGIILGCSNC-SNVBAGLBSA-N |
| XLogP | 4.70 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.24 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|