C21H24Cl2FN3O2 — CID 55922918
1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[[3-(morpholin-4-ylmethyl)phenyl]methyl]urea (PubChem CID 55922918) has the molecular formula C21H24Cl2FN3O2 and a molecular weight of 440.35 g/mol. Its IUPAC name is 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[[3-(morpholin-4-ylmethyl)phenyl]methyl]urea.
| Compound Name | 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[[3-(morpholin-4-ylmethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 55922918 |
| Molecular Formula | C21H24Cl2FN3O2 |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[[3-(morpholin-4-ylmethyl)phenyl]methyl]urea |
| SMILES | CC(NC(=O)NCc1cccc(CN2CCOCC2)c1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C21H24Cl2FN3O2/c1-14(17-10-20(24)19(23)11-18(17)22)26-21(28)25-12-15-3-2-4-16(9-15)13-27-5-7-29-8-6-27/h2-4,9-11,14H,5-8,12-13H2,1H3,(H2,25,26,28) |
| InChIKey | WQPXOTNOZBLQJN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|