C20H24Cl2FN3O3 — CID 55456763
1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]urea (PubChem CID 55456763) has the molecular formula C20H24Cl2FN3O3 and a molecular weight of 444.33 g/mol. Its IUPAC name is 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]urea.
| Compound Name | 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]urea |
|---|---|
| PubChem CID | 55456763 |
| Molecular Formula | C20H24Cl2FN3O3 |
| Molecular Weight | 444.33 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 1-[1-(2,4-dichloro-5-fluorophenyl)ethyl]-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]urea |
| SMILES | Cc1ccc(C(CNC(=O)NC(C)c2cc(F)c(Cl)cc2Cl)N2CCOCC2)o1 |
| InChI | InChI=1S/C20H24Cl2FN3O3/c1-12-3-4-19(29-12)18(26-5-7-28-8-6-26)11-24-20(27)25-13(2)14-9-17(23)16(22)10-15(14)21/h3-4,9-10,13,18H,5-8,11H2,1-2H3,(H2,24,25,27) |
| InChIKey | RBBGBKLAESUGNY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|