C16H26N2O3 — CID 51283060
3-methyl-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]butanamide (PubChem CID 51283060) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is 3-methyl-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]butanamide.
| Compound Name | 3-methyl-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]butanamide |
|---|---|
| PubChem CID | 51283060 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 3-methyl-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]butanamide |
| SMILES | Cc1ccc(C(CNC(=O)CC(C)C)N2CCOCC2)o1 |
| InChI | InChI=1S/C16H26N2O3/c1-12(2)10-16(19)17-11-14(15-5-4-13(3)21-15)18-6-8-20-9-7-18/h4-5,12,14H,6-11H2,1-3H3,(H,17,19) |
| InChIKey | ICWDZYUINWKKEF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |