C15H25N3O5S — CID 118763137
3-(methanesulfonamido)-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]propanamide (PubChem CID 118763137) has the molecular formula C15H25N3O5S and a molecular weight of 359.45 g/mol. Its IUPAC name is 3-(methanesulfonamido)-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]propanamide.
| Compound Name | 3-(methanesulfonamido)-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]propanamide |
|---|---|
| PubChem CID | 118763137 |
| Molecular Formula | C15H25N3O5S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 3-(methanesulfonamido)-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]propanamide |
| SMILES | Cc1ccc(C(CNC(=O)CCNS(C)(=O)=O)N2CCOCC2)o1 |
| InChI | InChI=1S/C15H25N3O5S/c1-12-3-4-14(23-12)13(18-7-9-22-10-8-18)11-16-15(19)5-6-17-24(2,20)21/h3-4,13,17H,5-11H2,1-2H3,(H,16,19) |
| InChIKey | PTPDCVBZYHUACD-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |