C20H33N3O4 — CID 134056195
2,2-dimethyl-N-[4-[[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]amino]-4-oxobutyl]propanamide (PubChem CID 134056195) has the molecular formula C20H33N3O4 and a molecular weight of 379.50 g/mol. Its IUPAC name is 2,2-dimethyl-N-[4-[[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]amino]-4-oxobutyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[4-[[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]amino]-4-oxobutyl]propanamide |
|---|---|
| PubChem CID | 134056195 |
| Molecular Formula | C20H33N3O4 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 2,2-dimethyl-N-[4-[[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]amino]-4-oxobutyl]propanamide |
| SMILES | Cc1ccc(C(CNC(=O)CCCNC(=O)C(C)(C)C)N2CCOCC2)o1 |
| InChI | InChI=1S/C20H33N3O4/c1-15-7-8-17(27-15)16(23-10-12-26-13-11-23)14-22-18(24)6-5-9-21-19(25)20(2,3)4/h7-8,16H,5-6,9-14H2,1-4H3,(H,21,25)(H,22,24) |
| InChIKey | HNTNJYVIAPCDOL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|