C21H27ClN2O3 — CID 24643835
3-(3-chloro-4-methylphenyl)-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]propanamide (PubChem CID 24643835) has the molecular formula C21H27ClN2O3 and a molecular weight of 390.91 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]propanamide.
| Compound Name | 3-(3-chloro-4-methylphenyl)-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]propanamide |
|---|---|
| PubChem CID | 24643835 |
| Molecular Formula | C21H27ClN2O3 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]propanamide |
| SMILES | Cc1ccc(C(CNC(=O)CCc2ccc(C)c(Cl)c2)N2CCOCC2)o1 |
| InChI | InChI=1S/C21H27ClN2O3/c1-15-3-5-17(13-18(15)22)6-8-21(25)23-14-19(20-7-4-16(2)27-20)24-9-11-26-12-10-24/h3-5,7,13,19H,6,8-12,14H2,1-2H3,(H,23,25) |
| InChIKey | ADNCXHBNQFCIMM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |