C20H25ClN2O4 — CID 18164100
2-(2-chloro-5-methylphenoxy)-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]acetamide (PubChem CID 18164100) has the molecular formula C20H25ClN2O4 and a molecular weight of 392.88 g/mol. Its IUPAC name is 2-(2-chloro-5-methylphenoxy)-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]acetamide.
| Compound Name | 2-(2-chloro-5-methylphenoxy)-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]acetamide |
|---|---|
| PubChem CID | 18164100 |
| Molecular Formula | C20H25ClN2O4 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 2-(2-chloro-5-methylphenoxy)-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]acetamide |
| SMILES | Cc1ccc(Cl)c(OCC(=O)NCC(c2ccc(C)o2)N2CCOCC2)c1 |
| InChI | InChI=1S/C20H25ClN2O4/c1-14-3-5-16(21)19(11-14)26-13-20(24)22-12-17(18-6-4-15(2)27-18)23-7-9-25-10-8-23/h3-6,11,17H,7-10,12-13H2,1-2H3,(H,22,24) |
| InChIKey | AQOUBEQOLQZCFB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |