C19H24FN3O3 — CID 86987160
1-(2-fluoro-4-methylphenyl)-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]urea (PubChem CID 86987160) has the molecular formula C19H24FN3O3 and a molecular weight of 361.42 g/mol. Its IUPAC name is 1-(2-fluoro-4-methylphenyl)-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]urea.
| Compound Name | 1-(2-fluoro-4-methylphenyl)-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]urea |
|---|---|
| PubChem CID | 86987160 |
| Molecular Formula | C19H24FN3O3 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 1-(2-fluoro-4-methylphenyl)-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]urea |
| SMILES | Cc1ccc(NC(=O)NCC(c2ccc(C)o2)N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C19H24FN3O3/c1-13-3-5-16(15(20)11-13)22-19(24)21-12-17(18-6-4-14(2)26-18)23-7-9-25-10-8-23/h3-6,11,17H,7-10,12H2,1-2H3,(H2,21,22,24) |
| InChIKey | JLEZUJVYACTVRI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |