C17H22N4O3 — CID 51083980
1-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]-3-pyridin-2-ylurea (PubChem CID 51083980) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 1-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]-3-pyridin-2-ylurea.
| Compound Name | 1-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]-3-pyridin-2-ylurea |
|---|---|
| PubChem CID | 51083980 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]-3-pyridin-2-ylurea |
| SMILES | Cc1ccc(C(CNC(=O)Nc2ccccn2)N2CCOCC2)o1 |
| InChI | InChI=1S/C17H22N4O3/c1-13-5-6-15(24-13)14(21-8-10-23-11-9-21)12-19-17(22)20-16-4-2-3-7-18-16/h2-7,14H,8-12H2,1H3,(H2,18,19,20,22) |
| InChIKey | STUJAASFKSEQBF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |