C19H23F2N3O4 — CID 86987370
1-[4-(difluoromethoxy)phenyl]-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]urea (PubChem CID 86987370) has the molecular formula C19H23F2N3O4 and a molecular weight of 395.41 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]urea.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]urea |
|---|---|
| PubChem CID | 86987370 |
| Molecular Formula | C19H23F2N3O4 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]urea |
| SMILES | Cc1ccc(C(CNC(=O)Nc2ccc(OC(F)F)cc2)N2CCOCC2)o1 |
| InChI | InChI=1S/C19H23F2N3O4/c1-13-2-7-17(27-13)16(24-8-10-26-11-9-24)12-22-19(25)23-14-3-5-15(6-4-14)28-18(20)21/h2-7,16,18H,8-12H2,1H3,(H2,22,23,25) |
| InChIKey | DOVAIICUTHHUEL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |