C18H24N4O5S — CID 55684084
1-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]-3-(3-sulfamoylphenyl)urea (PubChem CID 55684084) has the molecular formula C18H24N4O5S and a molecular weight of 408.48 g/mol. Its IUPAC name is 1-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]-3-(3-sulfamoylphenyl)urea.
| Compound Name | 1-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]-3-(3-sulfamoylphenyl)urea |
|---|---|
| PubChem CID | 55684084 |
| Molecular Formula | C18H24N4O5S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 1-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]-3-(3-sulfamoylphenyl)urea |
| SMILES | Cc1ccc(C(CNC(=O)Nc2cccc(S(N)(=O)=O)c2)N2CCOCC2)o1 |
| InChI | InChI=1S/C18H24N4O5S/c1-13-5-6-17(27-13)16(22-7-9-26-10-8-22)12-20-18(23)21-14-3-2-4-15(11-14)28(19,24)25/h2-6,11,16H,7-10,12H2,1H3,(H2,19,24,25)(H2,20,21,23) |
| InChIKey | VKGFIEKBORRYFQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 126.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |