C22H31F2IN4O3 — CID 111288276
1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]guanidine;hydroiodide (PubChem CID 111288276) has the molecular formula C22H31F2IN4O3 and a molecular weight of 564.42 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]guanidine;hydroiodide.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111288276 |
| Molecular Formula | C22H31F2IN4O3 |
| Molecular Weight | 564.42 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-1,2-dimethyl-3-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(c1ccc(C)o1)N1CCOCC1)N(C)Cc1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C22H30F2N4O3.HI/c1-16-4-9-20(30-16)19(28-10-12-29-13-11-28)14-26-22(25-2)27(3)15-17-5-7-18(8-6-17)31-21(23)24;/h4-9,19,21H,10-15H2,1-3H3,(H,25,26);1H |
| InChIKey | WRFMEJUJPVKWMR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|