C24H32F2IN3O3 — CID 111288546
1-[[4-(difluoromethoxy)phenyl]methyl]-3-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111288546) has the molecular formula C24H32F2IN3O3 and a molecular weight of 575.44 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111288546 |
| Molecular Formula | C24H32F2IN3O3 |
| Molecular Weight | 575.44 g/mol |
| Exact Mass | 575.15 |
| IUPAC Name | 1-[[4-(difluoromethoxy)phenyl]methyl]-3-[[4-(4-methoxyphenyl)oxan-4-yl]methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(/NCC1(c2ccc(OC)cc2)CCOCC1)N(C)Cc1ccc(OC(F)F)cc1.I |
| InChI | InChI=1S/C24H31F2N3O3.HI/c1-27-23(29(2)16-18-4-8-21(9-5-18)32-22(25)26)28-17-24(12-14-31-15-13-24)19-6-10-20(30-3)11-7-19;/h4-11,22H,12-17H2,1-3H3,(H,27,28);1H |
| InChIKey | CURFJDOGPLIJSZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|