C25H34IN3O4 — CID 111274576
3-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-1-[(4-ethoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111274576) has the molecular formula C25H34IN3O4 and a molecular weight of 567.47 g/mol. Its IUPAC name is 3-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-1-[(4-ethoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-1-[(4-ethoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111274576 |
| Molecular Formula | C25H34IN3O4 |
| Molecular Weight | 567.47 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | 3-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-1-[(4-ethoxyphenyl)methyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | CCOc1ccc(CN(C)/C(=N\C)NCC2(c3ccc4c(c3)OCO4)CCOCC2)cc1.I |
| InChI | InChI=1S/C25H33N3O4.HI/c1-4-30-21-8-5-19(6-9-21)16-28(3)24(26-2)27-17-25(11-13-29-14-12-25)20-7-10-22-23(15-20)32-18-31-22;/h5-10,15H,4,11-14,16-18H2,1-3H3,(H,26,27);1H |
| InChIKey | FWWCUXMGBBYJRZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 64.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|