C19H27N3O3 — CID 110934579
N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 110934579) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 110934579 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCC1(c2ccc3c(c2)OCO3)CCOCC1)N1CCCC1 |
| InChI | InChI=1S/C19H27N3O3/c1-20-18(22-8-2-3-9-22)21-13-19(6-10-23-11-7-19)15-4-5-16-17(12-15)25-14-24-16/h4-5,12H,2-3,6-11,13-14H2,1H3,(H,20,21) |
| InChIKey | QZZDKJLLLMOMBV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|