C23H39IN4O3 — CID 111246870
1-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-3-[2-[di(propan-2-yl)amino]ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111246870) has the molecular formula C23H39IN4O3 and a molecular weight of 546.49 g/mol. Its IUPAC name is 1-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-3-[2-[di(propan-2-yl)amino]ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-3-[2-[di(propan-2-yl)amino]ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111246870 |
| Molecular Formula | C23H39IN4O3 |
| Molecular Weight | 546.49 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | 1-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-3-[2-[di(propan-2-yl)amino]ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCN(C(C)C)C(C)C)NCC1(c2ccc3c(c2)OCO3)CCOCC1.I |
| InChI | InChI=1S/C23H38N4O3.HI/c1-17(2)27(18(3)4)11-10-25-22(24-5)26-15-23(8-12-28-13-9-23)19-6-7-20-21(14-19)30-16-29-20;/h6-7,14,17-18H,8-13,15-16H2,1-5H3,(H2,24,25,26);1H |
| InChIKey | WOVGOABAIADLCN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|