C20H32IN3O3S — CID 111610271
1-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide (PubChem CID 111610271) has the molecular formula C20H32IN3O3S and a molecular weight of 521.47 g/mol. Its IUPAC name is 1-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111610271 |
| Molecular Formula | C20H32IN3O3S |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | 1-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(C)(C)SC)NCC1(c2ccc3c(c2)OCO3)CCOCC1.I |
| InChI | InChI=1S/C20H31N3O3S.HI/c1-19(2,27-4)12-22-18(21-3)23-13-20(7-9-24-10-8-20)15-5-6-16-17(11-15)26-14-25-16;/h5-6,11H,7-10,12-14H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | ZXBBMOVANVHOOI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|