C25H39N3O4 — CID 111623430
1-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-3-[(2-tert-butyloxan-3-yl)methyl]-2-methylguanidine (PubChem CID 111623430) has the molecular formula C25H39N3O4 and a molecular weight of 445.60 g/mol. Its IUPAC name is 1-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-3-[(2-tert-butyloxan-3-yl)methyl]-2-methylguanidine.
| Compound Name | 1-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-3-[(2-tert-butyloxan-3-yl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111623430 |
| Molecular Formula | C25H39N3O4 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.29 |
| IUPAC Name | 1-[[4-(1,3-benzodioxol-5-yl)oxan-4-yl]methyl]-3-[(2-tert-butyloxan-3-yl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCC1CCCOC1C(C)(C)C)NCC1(c2ccc3c(c2)OCO3)CCOCC1 |
| InChI | InChI=1S/C25H39N3O4/c1-24(2,3)22-18(6-5-11-30-22)15-27-23(26-4)28-16-25(9-12-29-13-10-25)19-7-8-20-21(14-19)32-17-31-20/h7-8,14,18,22H,5-6,9-13,15-17H2,1-4H3,(H2,26,27,28) |
| InChIKey | XSWFXDMLPBVHOT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|