C21H31N3O3 — CID 119150987
1-[[1-(1,3-benzodioxol-5-yl)cyclohexyl]methyl]-2-methyl-3-(oxolan-3-ylmethyl)guanidine (PubChem CID 119150987) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is 1-[[1-(1,3-benzodioxol-5-yl)cyclohexyl]methyl]-2-methyl-3-(oxolan-3-ylmethyl)guanidine.
| Compound Name | 1-[[1-(1,3-benzodioxol-5-yl)cyclohexyl]methyl]-2-methyl-3-(oxolan-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 119150987 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | 1-[[1-(1,3-benzodioxol-5-yl)cyclohexyl]methyl]-2-methyl-3-(oxolan-3-ylmethyl)guanidine |
| SMILES | C/N=C(\NCC1CCOC1)NCC1(c2ccc3c(c2)OCO3)CCCCC1 |
| InChI | InChI=1S/C21H31N3O3/c1-22-20(23-12-16-7-10-25-13-16)24-14-21(8-3-2-4-9-21)17-5-6-18-19(11-17)27-15-26-18/h5-6,11,16H,2-4,7-10,12-15H2,1H3,(H2,22,23,24) |
| InChIKey | YBVARBWVFRKLFB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|