C20H22FN3O2 — CID 111232551
1-[[1-(1,3-benzodioxol-5-yl)cyclopropyl]methyl]-3-[(4-fluorophenyl)methyl]-2-methylguanidine (PubChem CID 111232551) has the molecular formula C20H22FN3O2 and a molecular weight of 355.41 g/mol. Its IUPAC name is 1-[[1-(1,3-benzodioxol-5-yl)cyclopropyl]methyl]-3-[(4-fluorophenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[[1-(1,3-benzodioxol-5-yl)cyclopropyl]methyl]-3-[(4-fluorophenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111232551 |
| Molecular Formula | C20H22FN3O2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 1-[[1-(1,3-benzodioxol-5-yl)cyclopropyl]methyl]-3-[(4-fluorophenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccc(F)cc1)NCC1(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C20H22FN3O2/c1-22-19(23-11-14-2-5-16(21)6-3-14)24-12-20(8-9-20)15-4-7-17-18(10-15)26-13-25-17/h2-7,10H,8-9,11-13H2,1H3,(H2,22,23,24) |
| InChIKey | RWUWHRSDKJZCBD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|