C24H27IN4O3 — CID 111590992
1-[[1-(1,3-benzodioxol-5-yl)cyclopropyl]methyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111590992) has the molecular formula C24H27IN4O3 and a molecular weight of 546.41 g/mol. Its IUPAC name is 1-[[1-(1,3-benzodioxol-5-yl)cyclopropyl]methyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[[1-(1,3-benzodioxol-5-yl)cyclopropyl]methyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111590992 |
| Molecular Formula | C24H27IN4O3 |
| Molecular Weight | 546.41 g/mol |
| Exact Mass | 546.11 |
| IUPAC Name | 1-[[1-(1,3-benzodioxol-5-yl)cyclopropyl]methyl]-2-methyl-3-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1coc(-c2ccc(C)cc2)n1)NCC1(c2ccc3c(c2)OCO3)CC1.I |
| InChI | InChI=1S/C24H26N4O3.HI/c1-16-3-5-17(6-4-16)22-28-19(13-29-22)12-26-23(25-2)27-14-24(9-10-24)18-7-8-20-21(11-18)31-15-30-20;/h3-8,11,13H,9-10,12,14-15H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | LCVBSAPTNPZTBT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|