C21H26IN3O3 — CID 111217190
1-[[1-(1,3-benzodioxol-5-yl)cyclopropyl]methyl]-3-[(2-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111217190) has the molecular formula C21H26IN3O3 and a molecular weight of 495.36 g/mol. Its IUPAC name is 1-[[1-(1,3-benzodioxol-5-yl)cyclopropyl]methyl]-3-[(2-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[1-(1,3-benzodioxol-5-yl)cyclopropyl]methyl]-3-[(2-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111217190 |
| Molecular Formula | C21H26IN3O3 |
| Molecular Weight | 495.36 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | 1-[[1-(1,3-benzodioxol-5-yl)cyclopropyl]methyl]-3-[(2-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccccc1OC)NCC1(c2ccc3c(c2)OCO3)CC1.I |
| InChI | InChI=1S/C21H25N3O3.HI/c1-22-20(23-12-15-5-3-4-6-17(15)25-2)24-13-21(9-10-21)16-7-8-18-19(11-16)27-14-26-18;/h3-8,11H,9-10,12-14H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | CFLBAOFCIJHZFB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|