C22H28BrN3O2 — CID 111216507
1-[[4-(4-bromophenyl)oxan-4-yl]methyl]-3-[(2-methoxyphenyl)methyl]-2-methylguanidine (PubChem CID 111216507) has the molecular formula C22H28BrN3O2 and a molecular weight of 446.39 g/mol. Its IUPAC name is 1-[[4-(4-bromophenyl)oxan-4-yl]methyl]-3-[(2-methoxyphenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[[4-(4-bromophenyl)oxan-4-yl]methyl]-3-[(2-methoxyphenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111216507 |
| Molecular Formula | C22H28BrN3O2 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 1-[[4-(4-bromophenyl)oxan-4-yl]methyl]-3-[(2-methoxyphenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccccc1OC)NCC1(c2ccc(Br)cc2)CCOCC1 |
| InChI | InChI=1S/C22H28BrN3O2/c1-24-21(25-15-17-5-3-4-6-20(17)27-2)26-16-22(11-13-28-14-12-22)18-7-9-19(23)10-8-18/h3-10H,11-16H2,1-2H3,(H2,24,25,26) |
| InChIKey | VWURAHQETHOOOB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|