C19H30BrN3OS — CID 111610374
1-[[4-(4-bromophenyl)oxan-4-yl]methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine (PubChem CID 111610374) has the molecular formula C19H30BrN3OS and a molecular weight of 428.44 g/mol. Its IUPAC name is 1-[[4-(4-bromophenyl)oxan-4-yl]methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine.
| Compound Name | 1-[[4-(4-bromophenyl)oxan-4-yl]methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine |
|---|---|
| PubChem CID | 111610374 |
| Molecular Formula | C19H30BrN3OS |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 1-[[4-(4-bromophenyl)oxan-4-yl]methyl]-2-methyl-3-(2-methyl-2-methylsulfanylpropyl)guanidine |
| SMILES | C/N=C(\NCC(C)(C)SC)NCC1(c2ccc(Br)cc2)CCOCC1 |
| InChI | InChI=1S/C19H30BrN3OS/c1-18(2,25-4)13-22-17(21-3)23-14-19(9-11-24-12-10-19)15-5-7-16(20)8-6-15/h5-8H,9-14H2,1-4H3,(H2,21,22,23) |
| InChIKey | BNVFGSXPYWKDMV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|