C22H29FIN3O — CID 111307317
1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[(4-phenyloxan-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111307317) has the molecular formula C22H29FIN3O and a molecular weight of 497.40 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[(4-phenyloxan-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[(4-phenyloxan-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111307317 |
| Molecular Formula | C22H29FIN3O |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1,2-dimethyl-3-[(4-phenyloxan-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC1(c2ccccc2)CCOCC1)N(C)Cc1ccc(F)cc1.I |
| InChI | InChI=1S/C22H28FN3O.HI/c1-24-21(26(2)16-18-8-10-20(23)11-9-18)25-17-22(12-14-27-15-13-22)19-6-4-3-5-7-19;/h3-11H,12-17H2,1-2H3,(H,24,25);1H |
| InChIKey | JAZALQDCDMMCOY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|