C20H27FN4OS — CID 109425132
3-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine (PubChem CID 109425132) has the molecular formula C20H27FN4OS and a molecular weight of 390.53 g/mol. Its IUPAC name is 3-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine.
| Compound Name | 3-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109425132 |
| Molecular Formula | C20H27FN4OS |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 3-[[4-(3-fluorophenyl)oxan-4-yl]methyl]-1,2-dimethyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCC1(c2cccc(F)c2)CCOCC1)N(C)Cc1csc(C)n1 |
| InChI | InChI=1S/C20H27FN4OS/c1-15-24-18(13-27-15)12-25(3)19(22-2)23-14-20(7-9-26-10-8-20)16-5-4-6-17(21)11-16/h4-6,11,13H,7-10,12,14H2,1-3H3,(H,22,23) |
| InChIKey | PPSBTSMBWUFZFH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|