C21H24F2N2O4 — CID 55519028
(E)-3-[2-(difluoromethoxy)phenyl]-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]prop-2-enamide (PubChem CID 55519028) has the molecular formula C21H24F2N2O4 and a molecular weight of 406.43 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 55519028 |
| Molecular Formula | C21H24F2N2O4 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]prop-2-enamide |
| SMILES | Cc1ccc(C(CNC(=O)/C=C/c2ccccc2OC(F)F)N2CCOCC2)o1 |
| InChI | InChI=1S/C21H24F2N2O4/c1-15-6-8-19(28-15)17(25-10-12-27-13-11-25)14-24-20(26)9-7-16-4-2-3-5-18(16)29-21(22)23/h2-9,17,21H,10-14H2,1H3,(H,24,26)/b9-7+ |
| InChIKey | XTTDEKVIEHPVNQ-VQHVLOKHSA-N |
| XLogP | 3.39 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|