C21H24F2N2O3 — CID 52523158
(E)-3-[2-(difluoromethoxy)phenyl]-N-[(2R)-2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]prop-2-enamide (PubChem CID 52523158) has the molecular formula C21H24F2N2O3 and a molecular weight of 390.43 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-N-[(2R)-2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[(2R)-2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 52523158 |
| Molecular Formula | C21H24F2N2O3 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-N-[(2R)-2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]prop-2-enamide |
| SMILES | Cc1ccc([C@@H](CNC(=O)/C=C/c2ccccc2OC(F)F)N2CCCC2)o1 |
| InChI | InChI=1S/C21H24F2N2O3/c1-15-8-10-19(27-15)17(25-12-4-5-13-25)14-24-20(26)11-9-16-6-2-3-7-18(16)28-21(22)23/h2-3,6-11,17,21H,4-5,12-14H2,1H3,(H,24,26)/b11-9+/t17-/m1/s1 |
| InChIKey | LSWYDHJMYTYHBB-QXLXQBSBSA-N |
| XLogP | 4.16 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|