C19H24N2O2 — CID 26834521
N-[(2R)-2-(5-methylfuran-2-yl)-2-piperidin-1-ylethyl]benzamide (PubChem CID 26834521) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is N-[(2R)-2-(5-methylfuran-2-yl)-2-piperidin-1-ylethyl]benzamide.
| Compound Name | N-[(2R)-2-(5-methylfuran-2-yl)-2-piperidin-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 26834521 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-[(2R)-2-(5-methylfuran-2-yl)-2-piperidin-1-ylethyl]benzamide |
| SMILES | Cc1ccc([C@@H](CNC(=O)c2ccccc2)N2CCCCC2)o1 |
| InChI | InChI=1S/C19H24N2O2/c1-15-10-11-18(23-15)17(21-12-6-3-7-13-21)14-20-19(22)16-8-4-2-5-9-16/h2,4-5,8-11,17H,3,6-7,12-14H2,1H3,(H,20,22)/t17-/m1/s1 |
| InChIKey | QJPNITKGWNAZOL-QGZVFWFLSA-N |
| XLogP | 3.55 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |