C18H23N3O2 — CID 95283314
6-methyl-N-[(2R)-2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]pyridine-3-carboxamide (PubChem CID 95283314) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 6-methyl-N-[(2R)-2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]pyridine-3-carboxamide.
| Compound Name | 6-methyl-N-[(2R)-2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 95283314 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 6-methyl-N-[(2R)-2-(5-methylfuran-2-yl)-2-pyrrolidin-1-ylethyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NC[C@H](c2ccc(C)o2)N2CCCC2)cn1 |
| InChI | InChI=1S/C18H23N3O2/c1-13-5-7-15(11-19-13)18(22)20-12-16(21-9-3-4-10-21)17-8-6-14(2)23-17/h5-8,11,16H,3-4,9-10,12H2,1-2H3,(H,20,22)/t16-/m1/s1 |
| InChIKey | UWQDLXXQQKYDGI-MRXNPFEDSA-N |
| XLogP | 2.86 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |