C26H26N2O3 — CID 24643832
N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]-4-(2-phenylethynyl)benzamide (PubChem CID 24643832) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]-4-(2-phenylethynyl)benzamide.
| Compound Name | N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]-4-(2-phenylethynyl)benzamide |
|---|---|
| PubChem CID | 24643832 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]-4-(2-phenylethynyl)benzamide |
| SMILES | Cc1ccc(C(CNC(=O)c2ccc(C#Cc3ccccc3)cc2)N2CCOCC2)o1 |
| InChI | InChI=1S/C26H26N2O3/c1-20-7-14-25(31-20)24(28-15-17-30-18-16-28)19-27-26(29)23-12-10-22(11-13-23)9-8-21-5-3-2-4-6-21/h2-7,10-14,24H,15-19H2,1H3,(H,27,29) |
| InChIKey | PTRQTUXFFXJGPH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|