C16H19BrN2O3S — CID 42895264
5-bromo-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]thiophene-3-carboxamide (PubChem CID 42895264) has the molecular formula C16H19BrN2O3S and a molecular weight of 399.31 g/mol. Its IUPAC name is 5-bromo-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]thiophene-3-carboxamide.
| Compound Name | 5-bromo-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 42895264 |
| Molecular Formula | C16H19BrN2O3S |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 5-bromo-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]thiophene-3-carboxamide |
| SMILES | Cc1ccc(C(CNC(=O)c2csc(Br)c2)N2CCOCC2)o1 |
| InChI | InChI=1S/C16H19BrN2O3S/c1-11-2-3-14(22-11)13(19-4-6-21-7-5-19)9-18-16(20)12-8-15(17)23-10-12/h2-3,8,10,13H,4-7,9H2,1H3,(H,18,20) |
| InChIKey | GNFAWEXXNUYOTA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |