C19H25N3O6S — CID 55821677
4-(methoxysulfamoyl)-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzamide (PubChem CID 55821677) has the molecular formula C19H25N3O6S and a molecular weight of 423.49 g/mol. Its IUPAC name is 4-(methoxysulfamoyl)-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzamide.
| Compound Name | 4-(methoxysulfamoyl)-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzamide |
|---|---|
| PubChem CID | 55821677 |
| Molecular Formula | C19H25N3O6S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 4-(methoxysulfamoyl)-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzamide |
| SMILES | CONS(=O)(=O)c1ccc(C(=O)NCC(c2ccc(C)o2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H25N3O6S/c1-14-3-8-18(28-14)17(22-9-11-27-12-10-22)13-20-19(23)15-4-6-16(7-5-15)29(24,25)21-26-2/h3-8,17,21H,9-13H2,1-2H3,(H,20,23) |
| InChIKey | SYEZWCCOXRBSOC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|