C20H26ClN3O6S — CID 55452162
4-chloro-3-[methoxy(methyl)sulfamoyl]-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzamide (PubChem CID 55452162) has the molecular formula C20H26ClN3O6S and a molecular weight of 471.96 g/mol. Its IUPAC name is 4-chloro-3-[methoxy(methyl)sulfamoyl]-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzamide.
| Compound Name | 4-chloro-3-[methoxy(methyl)sulfamoyl]-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzamide |
|---|---|
| PubChem CID | 55452162 |
| Molecular Formula | C20H26ClN3O6S |
| Molecular Weight | 471.96 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 4-chloro-3-[methoxy(methyl)sulfamoyl]-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzamide |
| SMILES | CON(C)S(=O)(=O)c1cc(C(=O)NCC(c2ccc(C)o2)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C20H26ClN3O6S/c1-14-4-7-18(30-14)17(24-8-10-29-11-9-24)13-22-20(25)15-5-6-16(21)19(12-15)31(26,27)23(2)28-3/h4-7,12,17H,8-11,13H2,1-3H3,(H,22,25) |
| InChIKey | CISZUVLZVKNUAU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 101.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.96 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|