C18H20Cl2N2O3 — CID 18168876
2,5-dichloro-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzamide (PubChem CID 18168876) has the molecular formula C18H20Cl2N2O3 and a molecular weight of 383.28 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzamide |
|---|---|
| PubChem CID | 18168876 |
| Molecular Formula | C18H20Cl2N2O3 |
| Molecular Weight | 383.28 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 2,5-dichloro-N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzamide |
| SMILES | Cc1ccc(C(CNC(=O)c2cc(Cl)ccc2Cl)N2CCOCC2)o1 |
| InChI | InChI=1S/C18H20Cl2N2O3/c1-12-2-5-17(25-12)16(22-6-8-24-9-7-22)11-21-18(23)14-10-13(19)3-4-15(14)20/h2-5,10,16H,6-9,11H2,1H3,(H,21,23) |
| InChIKey | SRMVTGJCYLKYOZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |