C19H23FN2O4 — CID 32707160
2-fluoro-4-methoxy-N-[(2S)-2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzamide (PubChem CID 32707160) has the molecular formula C19H23FN2O4 and a molecular weight of 362.40 g/mol. Its IUPAC name is 2-fluoro-4-methoxy-N-[(2S)-2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzamide.
| Compound Name | 2-fluoro-4-methoxy-N-[(2S)-2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzamide |
|---|---|
| PubChem CID | 32707160 |
| Molecular Formula | C19H23FN2O4 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-fluoro-4-methoxy-N-[(2S)-2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]benzamide |
| SMILES | COc1ccc(C(=O)NC[C@@H](c2ccc(C)o2)N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C19H23FN2O4/c1-13-3-6-18(26-13)17(22-7-9-25-10-8-22)12-21-19(23)15-5-4-14(24-2)11-16(15)20/h3-6,11,17H,7-10,12H2,1-2H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | DHUMQWUUHDMPKY-KRWDZBQOSA-N |
| XLogP | 2.54 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |